C9H12ClN3 — CID 105369616
5-chloro-N-(3-methylcyclobutyl)pyrimidin-4-amine (PubChem CID 105369616) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is 5-chloro-N-(3-methylcyclobutyl)pyrimidin-4-amine.
| Compound Name | 5-chloro-N-(3-methylcyclobutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 105369616 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-chloro-N-(3-methylcyclobutyl)pyrimidin-4-amine |
| SMILES | CC1CC(Nc2ncncc2Cl)C1 |
| InChI | InChI=1S/C9H12ClN3/c1-6-2-7(3-6)13-9-8(10)4-11-5-12-9/h4-7H,2-3H2,1H3,(H,11,12,13) |
| InChIKey | FOPZUTVLUIYBJB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |