C10H14ClN3 — CID 90877547
2-chloro-5-methyl-N-(3-methylcyclobutyl)pyrimidin-4-amine (PubChem CID 90877547) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 2-chloro-5-methyl-N-(3-methylcyclobutyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-5-methyl-N-(3-methylcyclobutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 90877547 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-chloro-5-methyl-N-(3-methylcyclobutyl)pyrimidin-4-amine |
| SMILES | Cc1cnc(Cl)nc1NC1CC(C)C1 |
| InChI | InChI=1S/C10H14ClN3/c1-6-3-8(4-6)13-9-7(2)5-12-10(11)14-9/h5-6,8H,3-4H2,1-2H3,(H,12,13,14) |
| InChIKey | BEEADFXYGSXEQT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |