C13H17ClN4O2 — CID 118394020
5-[(2-chloro-5-methylpyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 118394020) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 5-[(2-chloro-5-methylpyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | 5-[(2-chloro-5-methylpyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 118394020 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 5-[(2-chloro-5-methylpyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | Cc1cnc(Cl)nc1NC1CC2CN(C(=O)O)CC2C1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-7-4-15-12(14)17-11(7)16-10-2-8-5-18(13(19)20)6-9(8)3-10/h4,8-10H,2-3,5-6H2,1H3,(H,19,20)(H,15,16,17) |
| InChIKey | XUFZERQABJHDOB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |