C12H16Cl2N4O2S — CID 126665269
N-(2,5-dichloropyrimidin-4-yl)-2-methylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 126665269) has the molecular formula C12H16Cl2N4O2S and a molecular weight of 351.26 g/mol. Its IUPAC name is N-(2,5-dichloropyrimidin-4-yl)-2-methylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | N-(2,5-dichloropyrimidin-4-yl)-2-methylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 126665269 |
| Molecular Formula | C12H16Cl2N4O2S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | N-(2,5-dichloropyrimidin-4-yl)-2-methylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CS(=O)(=O)N1CC2CC(Nc3nc(Cl)ncc3Cl)CC2C1 |
| InChI | InChI=1S/C12H16Cl2N4O2S/c1-21(19,20)18-5-7-2-9(3-8(7)6-18)16-11-10(13)4-15-12(14)17-11/h4,7-9H,2-3,5-6H2,1H3,(H,15,16,17) |
| InChIKey | WUJQELFOOQEEHQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |