About 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine
2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine (PubChem CID 122417179) has the molecular formula C11H15Cl2N3
and a molecular weight of 260.17 g/mol. Its IUPAC name is 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine |
| PubChem CID | 122417179 |
| Molecular Formula | C11H15Cl2N3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine |
| SMILES | C[C@H]1CCC[C@@H](Nc2nc(Cl)ncc2Cl)C1 |
| InChI | InChI=1S/C11H15Cl2N3/c1-7-3-2-4-8(5-7)15-10-9(12)6-14-11(13)16-10/h6-8H,2-5H2,1H3,(H,14,15,16)/t7-,8+/m0/s1 |
| InChIKey | MTSURUWJKBMXEC-JGVFFNPUSA-N |
| XLogP | 3.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine?
The IUPAC name of 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine (CID 122417179) is 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine.
What is the SMILES notation for 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine?
The canonical SMILES for 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine is C[C@H]1CCC[C@@H](Nc2nc(Cl)ncc2Cl)C1.
What is the InChIKey of 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine?
The InChIKey is MTSURUWJKBMXEC-JGVFFNPUSA-N. The full InChI is InChI=1S/C11H15Cl2N3/c1-7-3-2-4-8(5-7)15-10-9(12)6-14-11(13)16-10/h6-8H,2-5H2,1H3,(H,14,15,16)/t7-,8+/m0/s1.
What are the key properties of 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine?
2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine has a molecular weight of 260.17 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-N-[(1R,3S)-3-methylcyclohexyl]pyrimidin-4-amine is sourced from PubChem (CID 122417179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).