C15H21ClN8O2S — CID 145273489
5-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfonamide (PubChem CID 145273489) has the molecular formula C15H21ClN8O2S and a molecular weight of 412.91 g/mol. Its IUPAC name is 5-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfonamide.
| Compound Name | 5-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfonamide |
|---|---|
| PubChem CID | 145273489 |
| Molecular Formula | C15H21ClN8O2S |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 5-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfonamide |
| SMILES | Cn1cc(Nc2ncc(Cl)c(NC3CC4CN(S(N)(=O)=O)CC4C3)n2)cn1 |
| InChI | InChI=1S/C15H21ClN8O2S/c1-23-8-12(4-19-23)21-15-18-5-13(16)14(22-15)20-11-2-9-6-24(27(17,25)26)7-10(9)3-11/h4-5,8-11H,2-3,6-7H2,1H3,(H2,17,25,26)(H2,18,20,21,22) |
| InChIKey | OPMGTMBSSVNYIG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |