C18H25ClN6O4S — CID 159910835
5-chloro-2-N-(1-methylpyrazol-4-yl)-4-N-[(3S,6R)-3-(propan-2-ylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrimidine-2,4-diamine (PubChem CID 159910835) has the molecular formula C18H25ClN6O4S and a molecular weight of 456.96 g/mol. Its IUPAC name is 5-chloro-2-N-(1-methylpyrazol-4-yl)-4-N-[(3S,6R)-3-(propan-2-ylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(1-methylpyrazol-4-yl)-4-N-[(3S,6R)-3-(propan-2-ylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 159910835 |
| Molecular Formula | C18H25ClN6O4S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 5-chloro-2-N-(1-methylpyrazol-4-yl)-4-N-[(3S,6R)-3-(propan-2-ylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)C[C@H]1COC2C1OC[C@H]2Nc1nc(Nc2cnn(C)c2)ncc1Cl |
| InChI | InChI=1S/C18H25ClN6O4S/c1-10(2)30(26,27)9-11-7-28-16-14(8-29-15(11)16)23-17-13(19)5-20-18(24-17)22-12-4-21-25(3)6-12/h4-6,10-11,14-16H,7-9H2,1-3H3,(H2,20,22,23,24)/t11-,14-,15?,16?/m1/s1 |
| InChIKey | SVHIZRNZYOHIMQ-GJQQOJJOSA-N |
| XLogP | 1.62 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |