C18H25ClN8O4S — CID 126688664
N-[(3S,6R)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrrolidine-1-sulfonamide (PubChem CID 126688664) has the molecular formula C18H25ClN8O4S and a molecular weight of 484.97 g/mol. Its IUPAC name is N-[(3S,6R)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[(3S,6R)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 126688664 |
| Molecular Formula | C18H25ClN8O4S |
| Molecular Weight | 484.97 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-[(3S,6R)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrrolidine-1-sulfonamide |
| SMILES | Cn1cc(Nc2ncc(Cl)c(N[C@H]3COC4C3OC[C@H]4NS(=O)(=O)N3CCCC3)n2)cn1 |
| InChI | InChI=1S/C18H25ClN8O4S/c1-26-8-11(6-21-26)22-18-20-7-12(19)17(24-18)23-13-9-30-16-14(10-31-15(13)16)25-32(28,29)27-4-2-3-5-27/h6-8,13-16,25H,2-5,9-10H2,1H3,(H2,20,22,23,24)/t13-,14+,15?,16?/m0/s1 |
| InChIKey | LNYGRRFXQHXZQF-QRNKSROTSA-N |
| XLogP | 0.48 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.97 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |