C19H27ClN6O4S — CID 159978412
4-N-[3-(tert-butylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-5-chloro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 159978412) has the molecular formula C19H27ClN6O4S and a molecular weight of 470.98 g/mol. Its IUPAC name is 4-N-[3-(tert-butylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-5-chloro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(tert-butylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-5-chloro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 159978412 |
| Molecular Formula | C19H27ClN6O4S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-N-[3-(tert-butylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-5-chloro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | Cn1cc(Nc2ncc(Cl)c(NC3COC4C(CS(=O)(=O)C(C)(C)C)COC34)n2)cn1 |
| InChI | InChI=1S/C19H27ClN6O4S/c1-19(2,3)31(27,28)10-11-8-29-16-14(9-30-15(11)16)24-17-13(20)6-21-18(25-17)23-12-5-22-26(4)7-12/h5-7,11,14-16H,8-10H2,1-4H3,(H2,21,23,24,25) |
| InChIKey | OFLKIHMTJOZWRX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |