C17H23ClN6O5S — CID 159827419
2-[[(3S,6R)-6-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methylsulfonyl]ethanol (PubChem CID 159827419) has the molecular formula C17H23ClN6O5S and a molecular weight of 458.93 g/mol. Its IUPAC name is 2-[[(3S,6R)-6-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methylsulfonyl]ethanol.
| Compound Name | 2-[[(3S,6R)-6-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methylsulfonyl]ethanol |
|---|---|
| PubChem CID | 159827419 |
| Molecular Formula | C17H23ClN6O5S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2-[[(3S,6R)-6-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methylsulfonyl]ethanol |
| SMILES | Cn1cc(Nc2ncc(Cl)c(N[C@@H]3COC4C3OC[C@@H]4CS(=O)(=O)CCO)n2)cn1 |
| InChI | InChI=1S/C17H23ClN6O5S/c1-24-6-11(4-20-24)21-17-19-5-12(18)16(23-17)22-13-8-29-14-10(7-28-15(13)14)9-30(26,27)3-2-25/h4-6,10,13-15,25H,2-3,7-9H2,1H3,(H2,19,21,22,23)/t10-,13-,14?,15?/m1/s1 |
| InChIKey | NNADVXFKQAPABG-CAUURFFESA-N |
| XLogP | 0.21 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |