C18H24ClFN6O4S — CID 157417232
5-chloro-4-N-[3-(2-fluoropropylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 157417232) has the molecular formula C18H24ClFN6O4S and a molecular weight of 474.95 g/mol. Its IUPAC name is 5-chloro-4-N-[3-(2-fluoropropylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-[3-(2-fluoropropylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 157417232 |
| Molecular Formula | C18H24ClFN6O4S |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 5-chloro-4-N-[3-(2-fluoropropylsulfonylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | CC(F)CS(=O)(=O)CC1COC2C(Nc3nc(Nc4cnn(C)c4)ncc3Cl)COC12 |
| InChI | InChI=1S/C18H24ClFN6O4S/c1-10(20)8-31(27,28)9-11-6-29-16-14(7-30-15(11)16)24-17-13(19)4-21-18(25-17)23-12-3-22-26(2)5-12/h3-5,10-11,14-16H,6-9H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | BOZNPCIBBFWGHJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |