C16H19ClF3N7O4S — CID 126688646
N-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,2,2-trifluoroethanesulfonamide (PubChem CID 126688646) has the molecular formula C16H19ClF3N7O4S and a molecular weight of 497.89 g/mol. Its IUPAC name is N-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 126688646 |
| Molecular Formula | C16H19ClF3N7O4S |
| Molecular Weight | 497.89 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,2,2-trifluoroethanesulfonamide |
| SMILES | Cn1cc(Nc2ncc(Cl)c(N[C@@H]3COC4C3OC[C@@H]4NS(=O)(=O)CC(F)(F)F)n2)cn1 |
| InChI | InChI=1S/C16H19ClF3N7O4S/c1-27-4-8(2-22-27)23-15-21-3-9(17)14(25-15)24-10-5-30-13-11(6-31-12(10)13)26-32(28,29)7-16(18,19)20/h2-4,10-13,26H,5-7H2,1H3,(H2,21,23,24,25)/t10-,11+,12?,13?/m1/s1 |
| InChIKey | SCUJOUNSGNGRGZ-IALDZJHCSA-N |
| XLogP | 1.04 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.89 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |