C18H22ClN7O3 — CID 126688691
1-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrrolidin-2-one (PubChem CID 126688691) has the molecular formula C18H22ClN7O3 and a molecular weight of 419.87 g/mol. Its IUPAC name is 1-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 126688691 |
| Molecular Formula | C18H22ClN7O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]pyrrolidin-2-one |
| SMILES | Cn1cc(Nc2ncc(Cl)c(N[C@@H]3COC4C3OC[C@@H]4N3CCCC3=O)n2)cn1 |
| InChI | InChI=1S/C18H22ClN7O3/c1-25-7-10(5-21-25)22-18-20-6-11(19)17(24-18)23-12-8-28-16-13(9-29-15(12)16)26-4-2-3-14(26)27/h5-7,12-13,15-16H,2-4,8-9H2,1H3,(H2,20,22,23,24)/t12-,13+,15?,16?/m1/s1 |
| InChIKey | AQPVLSZHUYSWFS-SQHUISNBSA-N |
| XLogP | 1.18 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |