C18H23ClN8O3 — CID 126705673
1-[3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-methylimidazolidin-2-one (PubChem CID 126705673) has the molecular formula C18H23ClN8O3 and a molecular weight of 434.89 g/mol. Its IUPAC name is 1-[3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-methylimidazolidin-2-one.
| Compound Name | 1-[3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 126705673 |
| Molecular Formula | C18H23ClN8O3 |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-[3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-methylimidazolidin-2-one |
| SMILES | CN1CCN(C2COC3C(Nc4nc(Nc5cnn(C)c5)ncc4Cl)COC32)C1=O |
| InChI | InChI=1S/C18H23ClN8O3/c1-25-3-4-27(18(25)28)13-9-30-14-12(8-29-15(13)14)23-16-11(19)6-20-17(24-16)22-10-5-21-26(2)7-10/h5-7,12-15H,3-4,8-9H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | KOOZZQHQMGFUEA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |