C18H26ClN7O3S — CID 126688732
N-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methylpropane-2-sulfinamide (PubChem CID 126688732) has the molecular formula C18H26ClN7O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is N-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 126688732 |
| Molecular Formula | C18H26ClN7O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[(3R,6S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methylpropane-2-sulfinamide |
| SMILES | Cn1cc(Nc2ncc(Cl)c(N[C@@H]3COC4C3OC[C@@H]4NS(=O)C(C)(C)C)n2)cn1 |
| InChI | InChI=1S/C18H26ClN7O3S/c1-18(2,3)30(27)25-13-9-29-14-12(8-28-15(13)14)23-16-11(19)6-20-17(24-16)22-10-5-21-26(4)7-10/h5-7,12-15,25H,8-9H2,1-4H3,(H2,20,22,23,24)/t12-,13+,14?,15?,30?/m1/s1 |
| InChIKey | SJTYIGKZKRWVTI-DWUMDOORSA-N |
| XLogP | 1.61 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |