C20H28ClN7O3S — CID 126665329
1-[4-[[5-chloro-4-[(2-cyclopropylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)amino]pyrimidin-2-yl]amino]pyrazol-1-yl]propan-2-ol (PubChem CID 126665329) has the molecular formula C20H28ClN7O3S and a molecular weight of 482.01 g/mol. Its IUPAC name is 1-[4-[[5-chloro-4-[(2-cyclopropylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)amino]pyrimidin-2-yl]amino]pyrazol-1-yl]propan-2-ol.
| Compound Name | 1-[4-[[5-chloro-4-[(2-cyclopropylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)amino]pyrimidin-2-yl]amino]pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 126665329 |
| Molecular Formula | C20H28ClN7O3S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 1-[4-[[5-chloro-4-[(2-cyclopropylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)amino]pyrimidin-2-yl]amino]pyrazol-1-yl]propan-2-ol |
| SMILES | CC(O)Cn1cc(Nc2ncc(Cl)c(NC3CC4CN(S(=O)(=O)C5CC5)CC4C3)n2)cn1 |
| InChI | InChI=1S/C20H28ClN7O3S/c1-12(29)8-27-11-16(6-23-27)25-20-22-7-18(21)19(26-20)24-15-4-13-9-28(10-14(13)5-15)32(30,31)17-2-3-17/h6-7,11-15,17,29H,2-5,8-10H2,1H3,(H2,22,24,25,26) |
| InChIKey | XMSFPGDGANKHJW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |