C18H24ClN7O — CID 118411006
1-[5-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-1-one (PubChem CID 118411006) has the molecular formula C18H24ClN7O and a molecular weight of 389.89 g/mol. Its IUPAC name is 1-[5-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-1-one.
| Compound Name | 1-[5-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 118411006 |
| Molecular Formula | C18H24ClN7O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[5-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-1-one |
| SMILES | CCC(=O)N1CC2CC(Nc3nc(Nc4cnn(C)c4)ncc3Cl)CC2C1 |
| InChI | InChI=1S/C18H24ClN7O/c1-3-16(27)26-8-11-4-13(5-12(11)9-26)22-17-15(19)7-20-18(24-17)23-14-6-21-25(2)10-14/h6-7,10-13H,3-5,8-9H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | LBZJOSOYGPTVDQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |