C16H22ClN7 — CID 118390103
4-N-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl)-5-chloro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 118390103) has the molecular formula C16H22ClN7 and a molecular weight of 347.85 g/mol. Its IUPAC name is 4-N-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl)-5-chloro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl)-5-chloro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118390103 |
| Molecular Formula | C16H22ClN7 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-N-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl)-5-chloro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | Cn1cc(Nc2ncc(Cl)c(NC3CCC4CNCC4C3)n2)cn1 |
| InChI | InChI=1S/C16H22ClN7/c1-24-9-13(7-20-24)22-16-19-8-14(17)15(23-16)21-12-3-2-10-5-18-6-11(10)4-12/h7-12,18H,2-6H2,1H3,(H2,19,21,22,23) |
| InChIKey | AAIBONISWIQQJE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |