C15H21ClN4O2S — CID 163556982
2-chloro-N-(1-methylsulfonylpiperidin-4-yl)-5-[(3E)-penta-1,3-dien-3-yl]pyrimidin-4-amine (PubChem CID 163556982) has the molecular formula C15H21ClN4O2S and a molecular weight of 356.88 g/mol. Its IUPAC name is 2-chloro-N-(1-methylsulfonylpiperidin-4-yl)-5-[(3E)-penta-1,3-dien-3-yl]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(1-methylsulfonylpiperidin-4-yl)-5-[(3E)-penta-1,3-dien-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163556982 |
| Molecular Formula | C15H21ClN4O2S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-chloro-N-(1-methylsulfonylpiperidin-4-yl)-5-[(3E)-penta-1,3-dien-3-yl]pyrimidin-4-amine |
| SMILES | C=C/C(=C\C)c1cnc(Cl)nc1NC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H21ClN4O2S/c1-4-11(5-2)13-10-17-15(16)19-14(13)18-12-6-8-20(9-7-12)23(3,21)22/h4-5,10,12H,1,6-9H2,2-3H3,(H,17,18,19)/b11-5+ |
| InChIKey | FNXIHNRVQUYSBU-VZUCSPMQSA-N |
| XLogP | 2.56 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|