C8H10ClN3OSi — CID 162245679
[2-chloro-4-(cyclopropylamino)pyrimidin-5-yl]-silylmethanone (PubChem CID 162245679) has the molecular formula C8H10ClN3OSi and a molecular weight of 227.73 g/mol. Its IUPAC name is [2-chloro-4-(cyclopropylamino)pyrimidin-5-yl]-silylmethanone.
| Compound Name | [2-chloro-4-(cyclopropylamino)pyrimidin-5-yl]-silylmethanone |
|---|---|
| PubChem CID | 162245679 |
| Molecular Formula | C8H10ClN3OSi |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [2-chloro-4-(cyclopropylamino)pyrimidin-5-yl]-silylmethanone |
| SMILES | O=C([SiH3])c1cnc(Cl)nc1NC1CC1 |
| InChI | InChI=1S/C8H10ClN3OSi/c9-8-10-3-5(7(13)14)6(12-8)11-4-1-2-4/h3-4H,1-2H2,14H3,(H,10,11,12) |
| InChIKey | ZXHLEZBUFUALLI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|