C13H16ClN3O3 — CID 156776378
2-chloro-4-[[6-(hydroxymethyl)spiro[3.3]heptan-2-yl]amino]pyrimidine-5-carboxylic acid (PubChem CID 156776378) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 2-chloro-4-[[6-(hydroxymethyl)spiro[3.3]heptan-2-yl]amino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-chloro-4-[[6-(hydroxymethyl)spiro[3.3]heptan-2-yl]amino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 156776378 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-chloro-4-[[6-(hydroxymethyl)spiro[3.3]heptan-2-yl]amino]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Cl)nc1NC1CC2(CC(CO)C2)C1 |
| InChI | InChI=1S/C13H16ClN3O3/c14-12-15-5-9(11(19)20)10(17-12)16-8-3-13(4-8)1-7(2-13)6-18/h5,7-8,18H,1-4,6H2,(H,19,20)(H,15,16,17) |
| InChIKey | FWLWXPCGLKXLCQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |