C8H8ClF2N3 — CID 169118139
2-chloro-N-cyclopropyl-5-(difluoromethyl)pyrimidin-4-amine (PubChem CID 169118139) has the molecular formula C8H8ClF2N3 and a molecular weight of 219.62 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-(difluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-cyclopropyl-5-(difluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 169118139 |
| Molecular Formula | C8H8ClF2N3 |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-(difluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)c1cnc(Cl)nc1NC1CC1 |
| InChI | InChI=1S/C8H8ClF2N3/c9-8-12-3-5(6(10)11)7(14-8)13-4-1-2-4/h3-4,6H,1-2H2,(H,12,13,14) |
| InChIKey | PXSPIWUSOLDEGN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |