C17H25ClF3N3 — CID 150346047
2-chloro-N-cyclopropyl-5-(10,10,10-trifluorodecyl)pyrimidin-4-amine (PubChem CID 150346047) has the molecular formula C17H25ClF3N3 and a molecular weight of 363.86 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-(10,10,10-trifluorodecyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-cyclopropyl-5-(10,10,10-trifluorodecyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 150346047 |
| Molecular Formula | C17H25ClF3N3 |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-(10,10,10-trifluorodecyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)CCCCCCCCCc1cnc(Cl)nc1NC1CC1 |
| InChI | InChI=1S/C17H25ClF3N3/c18-16-22-12-13(15(24-16)23-14-9-10-14)8-6-4-2-1-3-5-7-11-17(19,20)21/h12,14H,1-11H2,(H,22,23,24) |
| InChIKey | GSSRFJYHBOOBQC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|