C10H16ClN5 — CID 146275528
2-chloro-5-N-methyl-4-N-piperidin-4-ylpyrimidine-4,5-diamine (PubChem CID 146275528) has the molecular formula C10H16ClN5 and a molecular weight of 241.73 g/mol. Its IUPAC name is 2-chloro-5-N-methyl-4-N-piperidin-4-ylpyrimidine-4,5-diamine.
| Compound Name | 2-chloro-5-N-methyl-4-N-piperidin-4-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 146275528 |
| Molecular Formula | C10H16ClN5 |
| Molecular Weight | 241.73 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-chloro-5-N-methyl-4-N-piperidin-4-ylpyrimidine-4,5-diamine |
| SMILES | CNc1cnc(Cl)nc1NC1CCNCC1 |
| InChI | InChI=1S/C10H16ClN5/c1-12-8-6-14-10(11)16-9(8)15-7-2-4-13-5-3-7/h6-7,12-13H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | YBZOTZWEBGFRHB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.73 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |