C10H15ClN4 — CID 123942355
6-chloro-2-N-piperidin-4-ylpyridine-2,3-diamine (PubChem CID 123942355) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 6-chloro-2-N-piperidin-4-ylpyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-piperidin-4-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 123942355 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 6-chloro-2-N-piperidin-4-ylpyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1NC1CCNCC1 |
| InChI | InChI=1S/C10H15ClN4/c11-9-2-1-8(12)10(15-9)14-7-3-5-13-6-4-7/h1-2,7,13H,3-6,12H2,(H,14,15) |
| InChIKey | DPHAQIMFHQLMAM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|