C14H17FN4 — CID 82570043
5-fluoro-1-N-piperidin-4-ylisoquinoline-1,8-diamine (PubChem CID 82570043) has the molecular formula C14H17FN4 and a molecular weight of 260.32 g/mol. Its IUPAC name is 5-fluoro-1-N-piperidin-4-ylisoquinoline-1,8-diamine.
| Compound Name | 5-fluoro-1-N-piperidin-4-ylisoquinoline-1,8-diamine |
|---|---|
| PubChem CID | 82570043 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 5-fluoro-1-N-piperidin-4-ylisoquinoline-1,8-diamine |
| SMILES | Nc1ccc(F)c2ccnc(NC3CCNCC3)c12 |
| InChI | InChI=1S/C14H17FN4/c15-11-1-2-12(16)13-10(11)5-8-18-14(13)19-9-3-6-17-7-4-9/h1-2,5,8-9,17H,3-4,6-7,16H2,(H,18,19) |
| InChIKey | LHTCKYANKRFALF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|