C14H23N3 — CID 175211232
3,4-diethyl-N-piperidin-4-ylpyridin-2-amine (PubChem CID 175211232) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 3,4-diethyl-N-piperidin-4-ylpyridin-2-amine.
| Compound Name | 3,4-diethyl-N-piperidin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 175211232 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 3,4-diethyl-N-piperidin-4-ylpyridin-2-amine |
| SMILES | CCc1ccnc(NC2CCNCC2)c1CC |
| InChI | InChI=1S/C14H23N3/c1-3-11-5-10-16-14(13(11)4-2)17-12-6-8-15-9-7-12/h5,10,12,15H,3-4,6-9H2,1-2H3,(H,16,17) |
| InChIKey | RPLVSZAACKQBSG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |