C12H18FN3 — CID 171815594
N-[(3-fluoro-2-methyl-4-pyridinyl)methyl]piperidin-4-amine (PubChem CID 171815594) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is N-[(3-fluoro-2-methyl-4-pyridinyl)methyl]piperidin-4-amine.
| Compound Name | N-[(3-fluoro-2-methyl-4-pyridinyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 171815594 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | N-[(3-fluoro-2-methyl-4-pyridinyl)methyl]piperidin-4-amine |
| SMILES | Cc1nccc(CNC2CCNCC2)c1F |
| InChI | InChI=1S/C12H18FN3/c1-9-12(13)10(2-7-15-9)8-16-11-3-5-14-6-4-11/h2,7,11,14,16H,3-6,8H2,1H3 |
| InChIKey | KLFKLMIWBIZEFT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |