C16H24FN3 — CID 105389678
N-[[2-(4-ethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]cyclopropanamine (PubChem CID 105389678) has the molecular formula C16H24FN3 and a molecular weight of 277.39 g/mol. Its IUPAC name is N-[[2-(4-ethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(4-ethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 105389678 |
| Molecular Formula | C16H24FN3 |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-[[2-(4-ethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]cyclopropanamine |
| SMILES | CCC1CCN(c2nccc(CNC3CC3)c2F)CC1 |
| InChI | InChI=1S/C16H24FN3/c1-2-12-6-9-20(10-7-12)16-15(17)13(5-8-18-16)11-19-14-3-4-14/h5,8,12,14,19H,2-4,6-7,9-11H2,1H3 |
| InChIKey | AQYMEZMIFDIXGM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |