C17H28FN3 — CID 105385843
N-[[2-(4-ethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 105385843) has the molecular formula C17H28FN3 and a molecular weight of 293.43 g/mol. Its IUPAC name is N-[[2-(4-ethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-(4-ethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 105385843 |
| Molecular Formula | C17H28FN3 |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | N-[[2-(4-ethylpiperidin-1-yl)-3-fluoro-4-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCC1CCN(c2nccc(CNC(C)(C)C)c2F)CC1 |
| InChI | InChI=1S/C17H28FN3/c1-5-13-7-10-21(11-8-13)16-15(18)14(6-9-19-16)12-20-17(2,3)4/h6,9,13,20H,5,7-8,10-12H2,1-4H3 |
| InChIKey | AZBNWJZMVFYDTK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |