C13H16FN3 — CID 82569995
5-fluoro-1-N-(2-methylpropyl)isoquinoline-1,8-diamine (PubChem CID 82569995) has the molecular formula C13H16FN3 and a molecular weight of 233.29 g/mol. Its IUPAC name is 5-fluoro-1-N-(2-methylpropyl)isoquinoline-1,8-diamine.
| Compound Name | 5-fluoro-1-N-(2-methylpropyl)isoquinoline-1,8-diamine |
|---|---|
| PubChem CID | 82569995 |
| Molecular Formula | C13H16FN3 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 5-fluoro-1-N-(2-methylpropyl)isoquinoline-1,8-diamine |
| SMILES | CC(C)CNc1nccc2c(F)ccc(N)c12 |
| InChI | InChI=1S/C13H16FN3/c1-8(2)7-17-13-12-9(5-6-16-13)10(14)3-4-11(12)15/h3-6,8H,7,15H2,1-2H3,(H,16,17) |
| InChIKey | DTCYNOWUSSCFFD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|