C10H15FN2O — CID 105383169
[3-fluoro-2-(2-methylpropylamino)-4-pyridinyl]methanol (PubChem CID 105383169) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is [3-fluoro-2-(2-methylpropylamino)-4-pyridinyl]methanol.
| Compound Name | [3-fluoro-2-(2-methylpropylamino)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105383169 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | [3-fluoro-2-(2-methylpropylamino)-4-pyridinyl]methanol |
| SMILES | CC(C)CNc1nccc(CO)c1F |
| InChI | InChI=1S/C10H15FN2O/c1-7(2)5-13-10-9(11)8(6-14)3-4-12-10/h3-4,7,14H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | SLTANJHFQZIDOO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |