C9H13FN2O5S — CID 170992838
N-[3-fluoro-4-(hydroxymethyl)-2-pyridinyl]acetamide;methanesulfonic acid (PubChem CID 170992838) has the molecular formula C9H13FN2O5S and a molecular weight of 280.28 g/mol. Its IUPAC name is N-[3-fluoro-4-(hydroxymethyl)-2-pyridinyl]acetamide;methanesulfonic acid.
| Compound Name | N-[3-fluoro-4-(hydroxymethyl)-2-pyridinyl]acetamide;methanesulfonic acid |
|---|---|
| PubChem CID | 170992838 |
| Molecular Formula | C9H13FN2O5S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-[3-fluoro-4-(hydroxymethyl)-2-pyridinyl]acetamide;methanesulfonic acid |
| SMILES | CC(=O)Nc1nccc(CO)c1F.CS(=O)(=O)O |
| InChI | InChI=1S/C8H9FN2O2.CH4O3S/c1-5(13)11-8-7(9)6(4-12)2-3-10-8;1-5(2,3)4/h2-3,12H,4H2,1H3,(H,10,11,13);1H3,(H,2,3,4) |
| InChIKey | XYBSMHGMWMFZCK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|