C10H11FN2O4 — CID 156808791
(2-acetamido-3-fluoro-4-pyridinyl)methyl methyl carbonate (PubChem CID 156808791) has the molecular formula C10H11FN2O4 and a molecular weight of 242.21 g/mol. Its IUPAC name is (2-acetamido-3-fluoro-4-pyridinyl)methyl methyl carbonate.
| Compound Name | (2-acetamido-3-fluoro-4-pyridinyl)methyl methyl carbonate |
|---|---|
| PubChem CID | 156808791 |
| Molecular Formula | C10H11FN2O4 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (2-acetamido-3-fluoro-4-pyridinyl)methyl methyl carbonate |
| SMILES | COC(=O)OCc1ccnc(NC(C)=O)c1F |
| InChI | InChI=1S/C10H11FN2O4/c1-6(14)13-9-8(11)7(3-4-12-9)5-17-10(15)16-2/h3-4H,5H2,1-2H3,(H,12,13,14) |
| InChIKey | JVPXEIWYNNMQAM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |