C16H19N3O3 — CID 70163345
[3-(ethylamino)-2-(4-hydroxyanilino)-4-pyridinyl]methyl acetate (PubChem CID 70163345) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is [3-(ethylamino)-2-(4-hydroxyanilino)-4-pyridinyl]methyl acetate.
| Compound Name | [3-(ethylamino)-2-(4-hydroxyanilino)-4-pyridinyl]methyl acetate |
|---|---|
| PubChem CID | 70163345 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | [3-(ethylamino)-2-(4-hydroxyanilino)-4-pyridinyl]methyl acetate |
| SMILES | CCNc1c(COC(C)=O)ccnc1Nc1ccc(O)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-3-17-15-12(10-22-11(2)20)8-9-18-16(15)19-13-4-6-14(21)7-5-13/h4-9,17,21H,3,10H2,1-2H3,(H,18,19) |
| InChIKey | XTEIDTIZCABZCE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|