C17H21N3O2 — CID 159451507
tert-butyl 2-[4-[(3-amino-2-pyridinyl)amino]phenyl]acetate (PubChem CID 159451507) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is tert-butyl 2-[4-[(3-amino-2-pyridinyl)amino]phenyl]acetate.
| Compound Name | tert-butyl 2-[4-[(3-amino-2-pyridinyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 159451507 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | tert-butyl 2-[4-[(3-amino-2-pyridinyl)amino]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1ccc(Nc2ncccc2N)cc1 |
| InChI | InChI=1S/C17H21N3O2/c1-17(2,3)22-15(21)11-12-6-8-13(9-7-12)20-16-14(18)5-4-10-19-16/h4-10H,11,18H2,1-3H3,(H,19,20) |
| InChIKey | RUFRABFZJDAVHT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |