C14H19N3O4 — CID 90044554
tert-butyl 4-[(3-carbamoyl-2-pyridinyl)amino]-4-oxobutanoate (PubChem CID 90044554) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is tert-butyl 4-[(3-carbamoyl-2-pyridinyl)amino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[(3-carbamoyl-2-pyridinyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 90044554 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | tert-butyl 4-[(3-carbamoyl-2-pyridinyl)amino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)Nc1ncccc1C(N)=O |
| InChI | InChI=1S/C14H19N3O4/c1-14(2,3)21-11(19)7-6-10(18)17-13-9(12(15)20)5-4-8-16-13/h4-5,8H,6-7H2,1-3H3,(H2,15,20)(H,16,17,18) |
| InChIKey | XYHVFNJSJLLHSE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |