C8H10N4O2 — CID 88995807
2-(methylcarbamoylamino)pyridine-3-carboxamide (PubChem CID 88995807) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-(methylcarbamoylamino)pyridine-3-carboxamide.
| Compound Name | 2-(methylcarbamoylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88995807 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-(methylcarbamoylamino)pyridine-3-carboxamide |
| SMILES | CNC(=O)Nc1ncccc1C(N)=O |
| InChI | InChI=1S/C8H10N4O2/c1-10-8(14)12-7-5(6(9)13)3-2-4-11-7/h2-4H,1H3,(H2,9,13)(H2,10,11,12,14) |
| InChIKey | YAZCLUCLHIPAER-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |