C19H29N3O5 — CID 102540666
tert-butyl N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-2-pyridinyl]carbamate (PubChem CID 102540666) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 102540666 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | tert-butyl N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)c1cccnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29N3O5/c1-18(2,3)26-16(24)21-12-8-10-14(23)13-9-7-11-20-15(13)22-17(25)27-19(4,5)6/h7,9,11H,8,10,12H2,1-6H3,(H,21,24)(H,20,22,25) |
| InChIKey | ISSSKVSWUMBHRZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|