C19H30N2O3S — CID 102542254
tert-butyl N-[5-(2-tert-butylsulfanyl-3-pyridinyl)-5-oxopentyl]carbamate (PubChem CID 102542254) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is tert-butyl N-[5-(2-tert-butylsulfanyl-3-pyridinyl)-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-(2-tert-butylsulfanyl-3-pyridinyl)-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 102542254 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | tert-butyl N-[5-(2-tert-butylsulfanyl-3-pyridinyl)-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)c1cccnc1SC(C)(C)C |
| InChI | InChI=1S/C19H30N2O3S/c1-18(2,3)24-17(23)21-12-8-7-11-15(22)14-10-9-13-20-16(14)25-19(4,5)6/h9-10,13H,7-8,11-12H2,1-6H3,(H,21,23) |
| InChIKey | IDECOJKITAJNDL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|