C20H24N2O4 — CID 102539566
tert-butyl N-[4-oxo-4-(2-phenoxy-3-pyridinyl)butyl]carbamate (PubChem CID 102539566) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-(2-phenoxy-3-pyridinyl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-(2-phenoxy-3-pyridinyl)butyl]carbamate |
|---|---|
| PubChem CID | 102539566 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | tert-butyl N-[4-oxo-4-(2-phenoxy-3-pyridinyl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)c1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C20H24N2O4/c1-20(2,3)26-19(24)22-14-8-12-17(23)16-11-7-13-21-18(16)25-15-9-5-4-6-10-15/h4-7,9-11,13H,8,12,14H2,1-3H3,(H,22,24) |
| InChIKey | TWLLCNUIMHCYOY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|