C21H33N3O5 — CID 102540759
tert-butyl N-methyl-N-[3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-2-pyridinyl]carbamate (PubChem CID 102540759) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 102540759 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | tert-butyl N-methyl-N-[3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-2-pyridinyl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ncccc1C(=O)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33N3O5/c1-20(2,3)28-18(26)23-13-9-8-12-16(25)15-11-10-14-22-17(15)24(7)19(27)29-21(4,5)6/h10-11,14H,8-9,12-13H2,1-7H3,(H,23,26) |
| InChIKey | VJCISSRFTJAWDF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|