C15H22ClN3O4 — CID 153297641
1-chloroethyl N-methyl-N-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-pyridinyl]carbamate (PubChem CID 153297641) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is 1-chloroethyl N-methyl-N-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-pyridinyl]carbamate.
| Compound Name | 1-chloroethyl N-methyl-N-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 153297641 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-chloroethyl N-methyl-N-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-pyridinyl]carbamate |
| SMILES | CC(Cl)OC(=O)N(C)c1ncccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22ClN3O4/c1-10(16)22-14(21)19(5)12-11(7-6-8-17-12)9-18-13(20)23-15(2,3)4/h6-8,10H,9H2,1-5H3,(H,18,20) |
| InChIKey | HQMFWBLBQYWWNJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|