C19H28ClN3O5 — CID 58820603
tert-butyl N-[4-[2-[1-chloroethoxycarbonyl(methyl)amino]-3-pyridinyl]-2-oxobutyl]-N-methylcarbamate (PubChem CID 58820603) has the molecular formula C19H28ClN3O5 and a molecular weight of 413.90 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[1-chloroethoxycarbonyl(methyl)amino]-3-pyridinyl]-2-oxobutyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[2-[1-chloroethoxycarbonyl(methyl)amino]-3-pyridinyl]-2-oxobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58820603 |
| Molecular Formula | C19H28ClN3O5 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | tert-butyl N-[4-[2-[1-chloroethoxycarbonyl(methyl)amino]-3-pyridinyl]-2-oxobutyl]-N-methylcarbamate |
| SMILES | CC(Cl)OC(=O)N(C)c1ncccc1CCC(=O)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28ClN3O5/c1-13(20)27-18(26)23(6)16-14(8-7-11-21-16)9-10-15(24)12-22(5)17(25)28-19(2,3)4/h7-8,11,13H,9-10,12H2,1-6H3 |
| InChIKey | RYIZMHMYCNPZEU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|