C17H24ClN3O6 — CID 137471335
[2-[1-chloroethoxycarbonyl(methyl)amino]-3-pyridinyl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 137471335) has the molecular formula C17H24ClN3O6 and a molecular weight of 401.85 g/mol. Its IUPAC name is [2-[1-chloroethoxycarbonyl(methyl)amino]-3-pyridinyl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [2-[1-chloroethoxycarbonyl(methyl)amino]-3-pyridinyl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 137471335 |
| Molecular Formula | C17H24ClN3O6 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [2-[1-chloroethoxycarbonyl(methyl)amino]-3-pyridinyl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(Cl)OC(=O)N(C)c1ncccc1COC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24ClN3O6/c1-11(18)26-16(24)21(5)14-12(7-6-8-19-14)10-25-13(22)9-20-15(23)27-17(2,3)4/h6-8,11H,9-10H2,1-5H3,(H,20,23) |
| InChIKey | QZRMEAGMIJTVKW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|