C15H23N3O4 — CID 155282439
[2-[methyl(2-methylpropoxycarbonyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate (PubChem CID 155282439) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is [2-[methyl(2-methylpropoxycarbonyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate.
| Compound Name | [2-[methyl(2-methylpropoxycarbonyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate |
|---|---|
| PubChem CID | 155282439 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [2-[methyl(2-methylpropoxycarbonyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate |
| SMILES | CNCC(=O)OCc1cccnc1N(C)C(=O)OCC(C)C |
| InChI | InChI=1S/C15H23N3O4/c1-11(2)9-22-15(20)18(4)14-12(6-5-7-17-14)10-21-13(19)8-16-3/h5-7,11,16H,8-10H2,1-4H3 |
| InChIKey | SSJDZPTZPPVCOV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |