C25H44N4O8 — CID 158658709
ethane;3-[ethoxycarbonyl(methyl)amino]propyl acetate;[2-[methyl(propan-2-yloxycarbonyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate (PubChem CID 158658709) has the molecular formula C25H44N4O8 and a molecular weight of 528.65 g/mol. Its IUPAC name is ethane;3-[ethoxycarbonyl(methyl)amino]propyl acetate;[2-[methyl(propan-2-yloxycarbonyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate.
| Compound Name | ethane;3-[ethoxycarbonyl(methyl)amino]propyl acetate;[2-[methyl(propan-2-yloxycarbonyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate |
|---|---|
| PubChem CID | 158658709 |
| Molecular Formula | C25H44N4O8 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | ethane;3-[ethoxycarbonyl(methyl)amino]propyl acetate;[2-[methyl(propan-2-yloxycarbonyl)amino]-3-pyridinyl]methyl 2-(methylamino)acetate |
| SMILES | CC.CCOC(=O)N(C)CCCOC(C)=O.CNCC(=O)OCc1cccnc1N(C)C(=O)OC(C)C |
| InChI | InChI=1S/C14H21N3O4.C9H17NO4.C2H6/c1-10(2)21-14(19)17(4)13-11(6-5-7-16-13)9-20-12(18)8-15-3;1-4-13-9(12)10(3)6-5-7-14-8(2)11;1-2/h5-7,10,15H,8-9H2,1-4H3;4-7H2,1-3H3;1-2H3 |
| InChIKey | ICMCSPFDFNPZEB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|