C14H23N2O6P — CID 156628846
3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate (PubChem CID 156628846) has the molecular formula C14H23N2O6P and a molecular weight of 346.32 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate.
| Compound Name | 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 156628846 |
| Molecular Formula | C14H23N2O6P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate |
| SMILES | CC(OC(=O)N(C)c1ncccc1COP(=O)(O)O)C(C)(C)C |
| InChI | InChI=1S/C14H23N2O6P/c1-10(14(2,3)4)22-13(17)16(5)12-11(7-6-8-15-12)9-21-23(18,19)20/h6-8,10H,9H2,1-5H3,(H2,18,19,20) |
| InChIKey | CRDBWANRNJTWOB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|