About 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate
3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate (PubChem CID 156628846) has the molecular formula C14H23N2O6P
and a molecular weight of 346.32 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate.
Molecular Properties
| Compound Name | 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate |
| PubChem CID | 156628846 |
| Molecular Formula | C14H23N2O6P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate |
| SMILES | CC(OC(=O)N(C)c1ncccc1COP(=O)(O)O)C(C)(C)C |
| InChI | InChI=1S/C14H23N2O6P/c1-10(14(2,3)4)22-13(17)16(5)12-11(7-6-8-15-12)9-21-23(18,19)20/h6-8,10H,9H2,1-5H3,(H2,18,19,20) |
| InChIKey | CRDBWANRNJTWOB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate?
The IUPAC name of 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate (CID 156628846) is 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate.
What is the SMILES notation for 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate?
The canonical SMILES for 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate is CC(OC(=O)N(C)c1ncccc1COP(=O)(O)O)C(C)(C)C.
What is the InChIKey of 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate?
The InChIKey is CRDBWANRNJTWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N2O6P/c1-10(14(2,3)4)22-13(17)16(5)12-11(7-6-8-15-12)9-21-23(18,19)20/h6-8,10H,9H2,1-5H3,(H2,18,19,20).
What are the key properties of 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate?
3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate has a molecular weight of 346.32 g/mol, XLogP of 2.70, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutan-2-yl N-methyl-N-[3-(phosphonooxymethyl)-2-pyridinyl]carbamate is sourced from PubChem (CID 156628846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).