C24H34N3O9P — CID 176979551
benzyl 2-[[2-[butanoyl(methyl)amino]-3-pyridinyl]methyl-(phosphonooxymethoxycarbonyl)amino]acetate;ethane (PubChem CID 176979551) has the molecular formula C24H34N3O9P and a molecular weight of 539.52 g/mol. Its IUPAC name is benzyl 2-[[2-[butanoyl(methyl)amino]-3-pyridinyl]methyl-(phosphonooxymethoxycarbonyl)amino]acetate;ethane.
| Compound Name | benzyl 2-[[2-[butanoyl(methyl)amino]-3-pyridinyl]methyl-(phosphonooxymethoxycarbonyl)amino]acetate;ethane |
|---|---|
| PubChem CID | 176979551 |
| Molecular Formula | C24H34N3O9P |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | benzyl 2-[[2-[butanoyl(methyl)amino]-3-pyridinyl]methyl-(phosphonooxymethoxycarbonyl)amino]acetate;ethane |
| SMILES | CC.CCCC(=O)N(C)c1ncccc1CN(CC(=O)OCc1ccccc1)C(=O)OCOP(=O)(O)O |
| InChI | InChI=1S/C22H28N3O9P.C2H6/c1-3-8-19(26)24(2)21-18(11-7-12-23-21)13-25(22(28)33-16-34-35(29,30)31)14-20(27)32-15-17-9-5-4-6-10-17;1-2/h4-7,9-12H,3,8,13-16H2,1-2H3,(H2,29,30,31);1-2H3 |
| InChIKey | GZTVYNWCXJUMLS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|