C13H15N3O — CID 70162911
4-[[3-(ethylamino)-2-pyridinyl]amino]phenol (PubChem CID 70162911) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-[[3-(ethylamino)-2-pyridinyl]amino]phenol.
| Compound Name | 4-[[3-(ethylamino)-2-pyridinyl]amino]phenol |
|---|---|
| PubChem CID | 70162911 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-[[3-(ethylamino)-2-pyridinyl]amino]phenol |
| SMILES | CCNc1cccnc1Nc1ccc(O)cc1 |
| InChI | InChI=1S/C13H15N3O/c1-2-14-12-4-3-9-15-13(12)16-10-5-7-11(17)8-6-10/h3-9,14,17H,2H2,1H3,(H,15,16) |
| InChIKey | IZFGSMLWTHYWMA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|